C18H21ClN2O — CID 57124190
(1R)-2-[[(2S)-7-amino-1,2,3,4-tetrahydronaphthalen-2-yl]amino]-1-(3-chlorophenyl)ethanol (PubChem CID 57124190) has the molecular formula C18H21ClN2O and a molecular weight of 316.83 g/mol. Its IUPAC name is (1R)-2-[[(2S)-7-amino-1,2,3,4-tetrahydronaphthalen-2-yl]amino]-1-(3-chlorophenyl)ethanol.
| Compound Name | (1R)-2-[[(2S)-7-amino-1,2,3,4-tetrahydronaphthalen-2-yl]amino]-1-(3-chlorophenyl)ethanol |
|---|---|
| PubChem CID | 57124190 |
| Molecular Formula | C18H21ClN2O |
| Molecular Weight | 316.83 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | (1R)-2-[[(2S)-7-amino-1,2,3,4-tetrahydronaphthalen-2-yl]amino]-1-(3-chlorophenyl)ethanol |
| SMILES | Nc1ccc2c(c1)C[C@@H](NC[C@H](O)c1cccc(Cl)c1)CC2 |
| InChI | InChI=1S/C18H21ClN2O/c19-15-3-1-2-13(8-15)18(22)11-21-17-7-5-12-4-6-16(20)9-14(12)10-17/h1-4,6,8-9,17-18,21-22H,5,7,10-11,20H2/t17-,18-/m0/s1 |
| InChIKey | WOEDTVSIGLZGQJ-ROUUACIJSA-N |
| XLogP | 3.10 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.83 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|