C18H23Cl3N2O — CID 67685662
(1R)-2-[(7-amino-1,2,3,4-tetrahydronaphthalen-2-yl)amino]-1-(3-chlorophenyl)ethanol;dihydrochloride (PubChem CID 67685662) has the molecular formula C18H23Cl3N2O and a molecular weight of 389.75 g/mol. Its IUPAC name is (1R)-2-[(7-amino-1,2,3,4-tetrahydronaphthalen-2-yl)amino]-1-(3-chlorophenyl)ethanol;dihydrochloride.
| Compound Name | (1R)-2-[(7-amino-1,2,3,4-tetrahydronaphthalen-2-yl)amino]-1-(3-chlorophenyl)ethanol;dihydrochloride |
|---|---|
| PubChem CID | 67685662 |
| Molecular Formula | C18H23Cl3N2O |
| Molecular Weight | 389.75 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | (1R)-2-[(7-amino-1,2,3,4-tetrahydronaphthalen-2-yl)amino]-1-(3-chlorophenyl)ethanol;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccc2c(c1)CC(NC[C@H](O)c1cccc(Cl)c1)CC2 |
| InChI | InChI=1S/C18H21ClN2O.2ClH/c19-15-3-1-2-13(8-15)18(22)11-21-17-7-5-12-4-6-16(20)9-14(12)10-17;;/h1-4,6,8-9,17-18,21-22H,5,7,10-11,20H2;2*1H/t17?,18-;;/m0../s1 |
| InChIKey | QASZNJWBQJWKGM-GUBHWBGLSA-N |
| XLogP | 3.95 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.75 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|