C24H26ClNO7 — CID 67685474
3-[6-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]prop-2-enoic acid;oxalic acid (PubChem CID 67685474) has the molecular formula C24H26ClNO7 and a molecular weight of 475.93 g/mol. Its IUPAC name is 3-[6-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]prop-2-enoic acid;oxalic acid.
| Compound Name | 3-[6-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]prop-2-enoic acid;oxalic acid |
|---|---|
| PubChem CID | 67685474 |
| Molecular Formula | C24H26ClNO7 |
| Molecular Weight | 475.93 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | 3-[6-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]prop-2-enoic acid;oxalic acid |
| SMILES | O=C(O)C(=O)O.O=C(O)C=Cc1ccc2c(c1)CC(NC[C@H](O)c1cccc(Cl)c1)CCC2 |
| InChI | InChI=1S/C22H24ClNO3.C2H2O4/c23-19-5-1-4-17(12-19)21(25)14-24-20-6-2-3-16-9-7-15(8-10-22(26)27)11-18(16)13-20;3-1(4)2(5)6/h1,4-5,7-12,20-21,24-25H,2-3,6,13-14H2,(H,26,27);(H,3,4)(H,5,6)/t20?,21-;/m0./s1 |
| InChIKey | IVKDOQHZMPZAPJ-NPTNJNKCSA-N |
| XLogP | 3.16 |
| TPSA | 144.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.93 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|