C28H34ClNO10 — CID 18658901
diethyl 2-[[(6S)-6-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]oxy]propanedioate;oxalic acid (PubChem CID 18658901) has the molecular formula C28H34ClNO10 and a molecular weight of 580.03 g/mol. Its IUPAC name is diethyl 2-[[(6S)-6-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]oxy]propanedioate;oxalic acid.
| Compound Name | diethyl 2-[[(6S)-6-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]oxy]propanedioate;oxalic acid |
|---|---|
| PubChem CID | 18658901 |
| Molecular Formula | C28H34ClNO10 |
| Molecular Weight | 580.03 g/mol |
| Exact Mass | 579.19 |
| IUPAC Name | diethyl 2-[[(6S)-6-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]oxy]propanedioate;oxalic acid |
| SMILES | CCOC(=O)C(Oc1ccc2c(c1)C[C@@H](NC[C@H](O)c1cccc(Cl)c1)CCC2)C(=O)OCC.O=C(O)C(=O)O |
| InChI | InChI=1S/C26H32ClNO6.C2H2O4/c1-3-32-25(30)24(26(31)33-4-2)34-22-12-11-17-7-6-10-21(14-19(17)15-22)28-16-23(29)18-8-5-9-20(27)13-18;3-1(4)2(5)6/h5,8-9,11-13,15,21,23-24,28-29H,3-4,6-7,10,14,16H2,1-2H3;(H,3,4)(H,5,6)/t21-,23-;/m0./s1 |
| InChIKey | VUYNWIGRMYGCGZ-IUQUCOCYSA-N |
| XLogP | 2.94 |
| TPSA | 168.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.03 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|