C24H30ClNO4 — CID 67685575
ethyl 2-[[6-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]-5,6,7,8,9,10-hexahydrobenzo[8]annulen-3-yl]oxy]acetate (PubChem CID 67685575) has the molecular formula C24H30ClNO4 and a molecular weight of 431.96 g/mol. Its IUPAC name is ethyl 2-[[6-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]-5,6,7,8,9,10-hexahydrobenzo[8]annulen-3-yl]oxy]acetate.
| Compound Name | ethyl 2-[[6-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]-5,6,7,8,9,10-hexahydrobenzo[8]annulen-3-yl]oxy]acetate |
|---|---|
| PubChem CID | 67685575 |
| Molecular Formula | C24H30ClNO4 |
| Molecular Weight | 431.96 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | ethyl 2-[[6-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]-5,6,7,8,9,10-hexahydrobenzo[8]annulen-3-yl]oxy]acetate |
| SMILES | CCOC(=O)COc1ccc2c(c1)CC(NC[C@H](O)c1cccc(Cl)c1)CCCC2 |
| InChI | InChI=1S/C24H30ClNO4/c1-2-29-24(28)16-30-22-11-10-17-6-3-4-9-21(13-19(17)14-22)26-15-23(27)18-7-5-8-20(25)12-18/h5,7-8,10-12,14,21,23,26-27H,2-4,6,9,13,15-16H2,1H3/t21?,23-/m0/s1 |
| InChIKey | LXWQZKRISCFWAI-YANBTOMASA-N |
| XLogP | 4.24 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.96 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |