C24H31ClN2O4 — CID 18784189
2-[4-[3-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]cyclopentyl]phenoxy]-N-(2-methoxyethyl)acetamide (PubChem CID 18784189) has the molecular formula C24H31ClN2O4 and a molecular weight of 446.98 g/mol. Its IUPAC name is 2-[4-[3-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]cyclopentyl]phenoxy]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[4-[3-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]cyclopentyl]phenoxy]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 18784189 |
| Molecular Formula | C24H31ClN2O4 |
| Molecular Weight | 446.98 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 2-[4-[3-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]cyclopentyl]phenoxy]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)COc1ccc(C2CCC(NCC(O)c3cccc(Cl)c3)C2)cc1 |
| InChI | InChI=1S/C24H31ClN2O4/c1-30-12-11-26-24(29)16-31-22-9-6-17(7-10-22)18-5-8-21(14-18)27-15-23(28)19-3-2-4-20(25)13-19/h2-4,6-7,9-10,13,18,21,23,27-28H,5,8,11-12,14-16H2,1H3,(H,26,29) |
| InChIKey | QWKCZKPDVWUIQA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.98 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|