C22H25ClNO4- — CID 18784162
2-[2-[3-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]cyclohexyl]phenoxy]acetate (PubChem CID 18784162) has the molecular formula C22H25ClNO4- and a molecular weight of 402.90 g/mol. Its IUPAC name is 2-[2-[3-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]cyclohexyl]phenoxy]acetate.
| Compound Name | 2-[2-[3-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]cyclohexyl]phenoxy]acetate |
|---|---|
| PubChem CID | 18784162 |
| Molecular Formula | C22H25ClNO4- |
| Molecular Weight | 402.90 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 2-[2-[3-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]cyclohexyl]phenoxy]acetate |
| SMILES | O=C([O-])COc1ccccc1C1CCCC(NCC(O)c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C22H26ClNO4/c23-17-7-3-6-16(11-17)20(25)13-24-18-8-4-5-15(12-18)19-9-1-2-10-21(19)28-14-22(26)27/h1-3,6-7,9-11,15,18,20,24-25H,4-5,8,12-14H2,(H,26,27)/p-1 |
| InChIKey | LFLNZVFXGFRMBY-UHFFFAOYSA-M |
| XLogP | 2.82 |
| TPSA | 81.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.90 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |