C22H26ClNO4 — CID 18784166
2-[4-[3-[[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]methyl]cyclopentyl]phenoxy]acetic acid (PubChem CID 18784166) has the molecular formula C22H26ClNO4 and a molecular weight of 403.91 g/mol. Its IUPAC name is 2-[4-[3-[[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]methyl]cyclopentyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[3-[[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]methyl]cyclopentyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 18784166 |
| Molecular Formula | C22H26ClNO4 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 2-[4-[3-[[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]methyl]cyclopentyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(C2CCC(CNCC(O)c3cccc(Cl)c3)C2)cc1 |
| InChI | InChI=1S/C22H26ClNO4/c23-19-3-1-2-18(11-19)21(25)13-24-12-15-4-5-17(10-15)16-6-8-20(9-7-16)28-14-22(26)27/h1-3,6-9,11,15,17,21,24-25H,4-5,10,12-14H2,(H,26,27) |
| InChIKey | CKBXDCJPEQVDNK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |