C25H26ClNO4 — CID 67709653
[2-[3-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenyl] 2-phenoxyacetate (PubChem CID 67709653) has the molecular formula C25H26ClNO4 and a molecular weight of 439.94 g/mol. Its IUPAC name is [2-[3-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenyl] 2-phenoxyacetate.
| Compound Name | [2-[3-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenyl] 2-phenoxyacetate |
|---|---|
| PubChem CID | 67709653 |
| Molecular Formula | C25H26ClNO4 |
| Molecular Weight | 439.94 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | [2-[3-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenyl] 2-phenoxyacetate |
| SMILES | O=C(COc1ccccc1)Oc1ccccc1CCCNCC(O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C25H26ClNO4/c26-21-11-6-9-20(16-21)23(28)17-27-15-7-10-19-8-4-5-14-24(19)31-25(29)18-30-22-12-2-1-3-13-22/h1-6,8-9,11-14,16,23,27-28H,7,10,15,17-18H2 |
| InChIKey | BDVYNORLMGRCGU-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.94 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|