C27H31Cl2NO5 — CID 69102577
2-butoxy-4-[4-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethoxy]phenyl]benzoic acid;hydrochloride (PubChem CID 69102577) has the molecular formula C27H31Cl2NO5 and a molecular weight of 520.45 g/mol. Its IUPAC name is 2-butoxy-4-[4-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethoxy]phenyl]benzoic acid;hydrochloride.
| Compound Name | 2-butoxy-4-[4-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethoxy]phenyl]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 69102577 |
| Molecular Formula | C27H31Cl2NO5 |
| Molecular Weight | 520.45 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | 2-butoxy-4-[4-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethoxy]phenyl]benzoic acid;hydrochloride |
| SMILES | CCCCOc1cc(-c2ccc(OCCNC[C@H](O)c3cccc(Cl)c3)cc2)ccc1C(=O)O.Cl |
| InChI | InChI=1S/C27H30ClNO5.ClH/c1-2-3-14-34-26-17-20(9-12-24(26)27(31)32)19-7-10-23(11-8-19)33-15-13-29-18-25(30)21-5-4-6-22(28)16-21;/h4-12,16-17,25,29-30H,2-3,13-15,18H2,1H3,(H,31,32);1H/t25-;/m0./s1 |
| InChIKey | NPAKUVKFEVTCKC-UQIIZPHYSA-N |
| XLogP | 6.01 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.45 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|