C26H28ClNO4 — CID 69058621
4-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-2-prop-2-enoxybenzoic acid;hydrochloride (PubChem CID 69058621) has the molecular formula C26H28ClNO4 and a molecular weight of 453.97 g/mol. Its IUPAC name is 4-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-2-prop-2-enoxybenzoic acid;hydrochloride.
| Compound Name | 4-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-2-prop-2-enoxybenzoic acid;hydrochloride |
|---|---|
| PubChem CID | 69058621 |
| Molecular Formula | C26H28ClNO4 |
| Molecular Weight | 453.97 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 4-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-2-prop-2-enoxybenzoic acid;hydrochloride |
| SMILES | C=CCOc1cc(-c2ccc(CCNC[C@H](O)c3ccccc3)cc2)ccc1C(=O)O.Cl |
| InChI | InChI=1S/C26H27NO4.ClH/c1-2-16-31-25-17-22(12-13-23(25)26(29)30)20-10-8-19(9-11-20)14-15-27-18-24(28)21-6-4-3-5-7-21;/h2-13,17,24,27-28H,1,14-16,18H2,(H,29,30);1H/t24-;/m0./s1 |
| InChIKey | GVVBRYPUMWDAJA-JIDHJSLPSA-N |
| XLogP | 4.90 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.97 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|