C28H32N2O3 — CID 69054191
4-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-2-piperidin-1-ylbenzoic acid (PubChem CID 69054191) has the molecular formula C28H32N2O3 and a molecular weight of 444.58 g/mol. Its IUPAC name is 4-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-2-piperidin-1-ylbenzoic acid.
| Compound Name | 4-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-2-piperidin-1-ylbenzoic acid |
|---|---|
| PubChem CID | 69054191 |
| Molecular Formula | C28H32N2O3 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | 4-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-2-piperidin-1-ylbenzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(CCNC[C@H](O)c3ccccc3)cc2)cc1N1CCCCC1 |
| InChI | InChI=1S/C28H32N2O3/c31-27(23-7-3-1-4-8-23)20-29-16-15-21-9-11-22(12-10-21)24-13-14-25(28(32)33)26(19-24)30-17-5-2-6-18-30/h1,3-4,7-14,19,27,29,31H,2,5-6,15-18,20H2,(H,32,33)/t27-/m0/s1 |
| InChIKey | BLMIIBHYVIHPGY-MHZLTWQESA-N |
| XLogP | 4.91 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|