C25H27NO5S — CID 69103724
2-ethylsulfonyl-4-[4-[2-[[(2S)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]benzoic acid (PubChem CID 69103724) has the molecular formula C25H27NO5S and a molecular weight of 453.56 g/mol. Its IUPAC name is 2-ethylsulfonyl-4-[4-[2-[[(2S)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]benzoic acid.
| Compound Name | 2-ethylsulfonyl-4-[4-[2-[[(2S)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 69103724 |
| Molecular Formula | C25H27NO5S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 2-ethylsulfonyl-4-[4-[2-[[(2S)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]benzoic acid |
| SMILES | CCS(=O)(=O)c1cc(-c2ccc(CCNC[C@@H](O)c3ccccc3)cc2)ccc1C(=O)O |
| InChI | InChI=1S/C25H27NO5S/c1-2-32(30,31)24-16-21(12-13-22(24)25(28)29)19-10-8-18(9-11-19)14-15-26-17-23(27)20-6-4-3-5-7-20/h3-13,16,23,26-27H,2,14-15,17H2,1H3,(H,28,29)/t23-/m1/s1 |
| InChIKey | NSFKSKBKEIORNS-HSZRJFAPSA-N |
| XLogP | 3.71 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|