C30H38N2O5S — CID 69103728
4-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-N-(2-methylpropylsulfonyl)-2-propan-2-yloxybenzamide (PubChem CID 69103728) has the molecular formula C30H38N2O5S and a molecular weight of 538.71 g/mol. Its IUPAC name is 4-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-N-(2-methylpropylsulfonyl)-2-propan-2-yloxybenzamide.
| Compound Name | 4-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-N-(2-methylpropylsulfonyl)-2-propan-2-yloxybenzamide |
|---|---|
| PubChem CID | 69103728 |
| Molecular Formula | C30H38N2O5S |
| Molecular Weight | 538.71 g/mol |
| Exact Mass | 538.25 |
| IUPAC Name | 4-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-N-(2-methylpropylsulfonyl)-2-propan-2-yloxybenzamide |
| SMILES | CC(C)CS(=O)(=O)NC(=O)c1ccc(-c2ccc(CCNC[C@H](O)c3ccccc3)cc2)cc1OC(C)C |
| InChI | InChI=1S/C30H38N2O5S/c1-21(2)20-38(35,36)32-30(34)27-15-14-26(18-29(27)37-22(3)4)24-12-10-23(11-13-24)16-17-31-19-28(33)25-8-6-5-7-9-25/h5-15,18,21-22,28,31,33H,16-17,19-20H2,1-4H3,(H,32,34)/t28-/m0/s1 |
| InChIKey | XDOLFKVEMGTCJY-NDEPHWFRSA-N |
| XLogP | 4.72 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.71 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|