C28H35N3O6S — CID 67097176
N-(3-hydroxypropylsulfonyl)-4-[4-[2-[[(2S)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-2-propan-2-yloxybenzamide (PubChem CID 67097176) has the molecular formula C28H35N3O6S and a molecular weight of 541.67 g/mol. Its IUPAC name is N-(3-hydroxypropylsulfonyl)-4-[4-[2-[[(2S)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-2-propan-2-yloxybenzamide.
| Compound Name | N-(3-hydroxypropylsulfonyl)-4-[4-[2-[[(2S)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-2-propan-2-yloxybenzamide |
|---|---|
| PubChem CID | 67097176 |
| Molecular Formula | C28H35N3O6S |
| Molecular Weight | 541.67 g/mol |
| Exact Mass | 541.22 |
| IUPAC Name | N-(3-hydroxypropylsulfonyl)-4-[4-[2-[[(2S)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-2-propan-2-yloxybenzamide |
| SMILES | CC(C)Oc1cc(-c2ccc(CCNC[C@@H](O)c3cccnc3)cc2)ccc1C(=O)NS(=O)(=O)CCCO |
| InChI | InChI=1S/C28H35N3O6S/c1-20(2)37-27-17-23(10-11-25(27)28(34)31-38(35,36)16-4-15-32)22-8-6-21(7-9-22)12-14-30-19-26(33)24-5-3-13-29-18-24/h3,5-11,13,17-18,20,26,30,32-33H,4,12,14-16,19H2,1-2H3,(H,31,34)/t26-/m1/s1 |
| InChIKey | DQCPJHNWFIALFV-AREMUKBSSA-N |
| XLogP | 2.84 |
| TPSA | 137.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.67 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|