C31H38N2O5S — CID 67097970
2-cyclopentyl-4-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-N-(3-hydroxypropylsulfonyl)benzamide (PubChem CID 67097970) has the molecular formula C31H38N2O5S and a molecular weight of 550.72 g/mol. Its IUPAC name is 2-cyclopentyl-4-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-N-(3-hydroxypropylsulfonyl)benzamide.
| Compound Name | 2-cyclopentyl-4-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-N-(3-hydroxypropylsulfonyl)benzamide |
|---|---|
| PubChem CID | 67097970 |
| Molecular Formula | C31H38N2O5S |
| Molecular Weight | 550.72 g/mol |
| Exact Mass | 550.25 |
| IUPAC Name | 2-cyclopentyl-4-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-N-(3-hydroxypropylsulfonyl)benzamide |
| SMILES | O=C(NS(=O)(=O)CCCO)c1ccc(-c2ccc(CCNC[C@H](O)c3ccccc3)cc2)cc1C1CCCC1 |
| InChI | InChI=1S/C31H38N2O5S/c34-19-6-20-39(37,38)33-31(36)28-16-15-27(21-29(28)25-7-4-5-8-25)24-13-11-23(12-14-24)17-18-32-22-30(35)26-9-2-1-3-10-26/h1-3,9-16,21,25,30,32,34-35H,4-8,17-20,22H2,(H,33,36)/t30-/m0/s1 |
| InChIKey | XMBNLJPEWMMCCF-PMERELPUSA-N |
| XLogP | 4.32 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.72 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|