C29H37Cl2N3O4S — CID 69103970
4-[4-[2-[[(2S)-2-(4-aminophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]-2-cyclopentyl-N-methylsulfonylbenzamide;dihydrochloride (PubChem CID 69103970) has the molecular formula C29H37Cl2N3O4S and a molecular weight of 594.61 g/mol. Its IUPAC name is 4-[4-[2-[[(2S)-2-(4-aminophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]-2-cyclopentyl-N-methylsulfonylbenzamide;dihydrochloride.
| Compound Name | 4-[4-[2-[[(2S)-2-(4-aminophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]-2-cyclopentyl-N-methylsulfonylbenzamide;dihydrochloride |
|---|---|
| PubChem CID | 69103970 |
| Molecular Formula | C29H37Cl2N3O4S |
| Molecular Weight | 594.61 g/mol |
| Exact Mass | 593.19 |
| IUPAC Name | 4-[4-[2-[[(2S)-2-(4-aminophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]-2-cyclopentyl-N-methylsulfonylbenzamide;dihydrochloride |
| SMILES | CS(=O)(=O)NC(=O)c1ccc(-c2ccc(CCNC[C@@H](O)c3ccc(N)cc3)cc2)cc1C1CCCC1.Cl.Cl |
| InChI | InChI=1S/C29H35N3O4S.2ClH/c1-37(35,36)32-29(34)26-15-12-24(18-27(26)22-4-2-3-5-22)21-8-6-20(7-9-21)16-17-31-19-28(33)23-10-13-25(30)14-11-23;;/h6-15,18,22,28,31,33H,2-5,16-17,19,30H2,1H3,(H,32,34);2*1H/t28-;;/m1../s1 |
| InChIKey | WYKZJRIERSXDQX-QDSLRZTOSA-N |
| XLogP | 4.99 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.61 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|