C30H39N3O5S — CID 11606449
4-[4-[2-[[(2R)-2-(4-aminophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]-N-(3-hydroxypropylsulfonyl)-2-(2-methylpropyl)benzamide (PubChem CID 11606449) has the molecular formula C30H39N3O5S and a molecular weight of 553.73 g/mol. Its IUPAC name is 4-[4-[2-[[(2R)-2-(4-aminophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]-N-(3-hydroxypropylsulfonyl)-2-(2-methylpropyl)benzamide.
| Compound Name | 4-[4-[2-[[(2R)-2-(4-aminophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]-N-(3-hydroxypropylsulfonyl)-2-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 11606449 |
| Molecular Formula | C30H39N3O5S |
| Molecular Weight | 553.73 g/mol |
| Exact Mass | 553.26 |
| IUPAC Name | 4-[4-[2-[[(2R)-2-(4-aminophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]-N-(3-hydroxypropylsulfonyl)-2-(2-methylpropyl)benzamide |
| SMILES | CC(C)Cc1cc(-c2ccc(CCNC[C@H](O)c3ccc(N)cc3)cc2)ccc1C(=O)NS(=O)(=O)CCCO |
| InChI | InChI=1S/C30H39N3O5S/c1-21(2)18-26-19-25(10-13-28(26)30(36)33-39(37,38)17-3-16-34)23-6-4-22(5-7-23)14-15-32-20-29(35)24-8-11-27(31)12-9-24/h4-13,19,21,29,32,34-35H,3,14-18,20,31H2,1-2H3,(H,33,36)/t29-/m0/s1 |
| InChIKey | ISBQNGDUOFPRSE-LJAQVGFWSA-N |
| XLogP | 3.44 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.73 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|