C31H39ClN2O6S — CID 67097396
2-cyclopentyl-4-[4-[2-[[(2S)-2-hydroxy-2-phenylethyl]amino]ethoxy]phenyl]-N-(3-hydroxypropylsulfonyl)benzamide;hydrochloride (PubChem CID 67097396) has the molecular formula C31H39ClN2O6S and a molecular weight of 603.18 g/mol. Its IUPAC name is 2-cyclopentyl-4-[4-[2-[[(2S)-2-hydroxy-2-phenylethyl]amino]ethoxy]phenyl]-N-(3-hydroxypropylsulfonyl)benzamide;hydrochloride.
| Compound Name | 2-cyclopentyl-4-[4-[2-[[(2S)-2-hydroxy-2-phenylethyl]amino]ethoxy]phenyl]-N-(3-hydroxypropylsulfonyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 67097396 |
| Molecular Formula | C31H39ClN2O6S |
| Molecular Weight | 603.18 g/mol |
| Exact Mass | 602.22 |
| IUPAC Name | 2-cyclopentyl-4-[4-[2-[[(2S)-2-hydroxy-2-phenylethyl]amino]ethoxy]phenyl]-N-(3-hydroxypropylsulfonyl)benzamide;hydrochloride |
| SMILES | Cl.O=C(NS(=O)(=O)CCCO)c1ccc(-c2ccc(OCCNC[C@@H](O)c3ccccc3)cc2)cc1C1CCCC1 |
| InChI | InChI=1S/C31H38N2O6S.ClH/c34-18-6-20-40(37,38)33-31(36)28-16-13-26(21-29(28)24-7-4-5-8-24)23-11-14-27(15-12-23)39-19-17-32-22-30(35)25-9-2-1-3-10-25;/h1-3,9-16,21,24,30,32,34-35H,4-8,17-20,22H2,(H,33,36);1H/t30-;/m1./s1 |
| InChIKey | GZDWMQCJAJAHNP-VNUFCWELSA-N |
| XLogP | 4.58 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.18 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|