C30H37N3O5S — CID 69103611
2-(cyclohexylamino)-4-[4-[2-[[(2S)-2-hydroxy-2-phenylethyl]amino]ethoxy]phenyl]-N-methylsulfonylbenzamide (PubChem CID 69103611) has the molecular formula C30H37N3O5S and a molecular weight of 551.71 g/mol. Its IUPAC name is 2-(cyclohexylamino)-4-[4-[2-[[(2S)-2-hydroxy-2-phenylethyl]amino]ethoxy]phenyl]-N-methylsulfonylbenzamide.
| Compound Name | 2-(cyclohexylamino)-4-[4-[2-[[(2S)-2-hydroxy-2-phenylethyl]amino]ethoxy]phenyl]-N-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 69103611 |
| Molecular Formula | C30H37N3O5S |
| Molecular Weight | 551.71 g/mol |
| Exact Mass | 551.25 |
| IUPAC Name | 2-(cyclohexylamino)-4-[4-[2-[[(2S)-2-hydroxy-2-phenylethyl]amino]ethoxy]phenyl]-N-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)NC(=O)c1ccc(-c2ccc(OCCNC[C@@H](O)c3ccccc3)cc2)cc1NC1CCCCC1 |
| InChI | InChI=1S/C30H37N3O5S/c1-39(36,37)33-30(35)27-17-14-24(20-28(27)32-25-10-6-3-7-11-25)22-12-15-26(16-13-22)38-19-18-31-21-29(34)23-8-4-2-5-9-23/h2,4-5,8-9,12-17,20,25,29,31-32,34H,3,6-7,10-11,18-19,21H2,1H3,(H,33,35)/t29-/m1/s1 |
| InChIKey | KDHBWKYMKFODOI-GDLZYMKVSA-N |
| XLogP | 4.49 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.71 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|