C31H38N2O6S — CID 67098050
2-cyclohexyloxy-N-(2-hydroxyethylsulfonyl)-4-[4-[2-[[(2S)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]benzamide (PubChem CID 67098050) has the molecular formula C31H38N2O6S and a molecular weight of 566.72 g/mol. Its IUPAC name is 2-cyclohexyloxy-N-(2-hydroxyethylsulfonyl)-4-[4-[2-[[(2S)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]benzamide.
| Compound Name | 2-cyclohexyloxy-N-(2-hydroxyethylsulfonyl)-4-[4-[2-[[(2S)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]benzamide |
|---|---|
| PubChem CID | 67098050 |
| Molecular Formula | C31H38N2O6S |
| Molecular Weight | 566.72 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | 2-cyclohexyloxy-N-(2-hydroxyethylsulfonyl)-4-[4-[2-[[(2S)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]benzamide |
| SMILES | O=C(NS(=O)(=O)CCO)c1ccc(-c2ccc(CCNC[C@@H](O)c3ccccc3)cc2)cc1OC1CCCCC1 |
| InChI | InChI=1S/C31H38N2O6S/c34-19-20-40(37,38)33-31(36)28-16-15-26(21-30(28)39-27-9-5-2-6-10-27)24-13-11-23(12-14-24)17-18-32-22-29(35)25-7-3-1-4-8-25/h1,3-4,7-8,11-16,21,27,29,32,34-35H,2,5-6,9-10,17-20,22H2,(H,33,36)/t29-/m1/s1 |
| InChIKey | OCWGZVXPZYEXBB-GDLZYMKVSA-N |
| XLogP | 3.98 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.72 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|