C30H34N4O5S — CID 67098027
N-(cyanomethylsulfonyl)-2-cyclohexyloxy-4-[4-[2-[[(2S)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]benzamide (PubChem CID 67098027) has the molecular formula C30H34N4O5S and a molecular weight of 562.69 g/mol. Its IUPAC name is N-(cyanomethylsulfonyl)-2-cyclohexyloxy-4-[4-[2-[[(2S)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]benzamide.
| Compound Name | N-(cyanomethylsulfonyl)-2-cyclohexyloxy-4-[4-[2-[[(2S)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]benzamide |
|---|---|
| PubChem CID | 67098027 |
| Molecular Formula | C30H34N4O5S |
| Molecular Weight | 562.69 g/mol |
| Exact Mass | 562.22 |
| IUPAC Name | N-(cyanomethylsulfonyl)-2-cyclohexyloxy-4-[4-[2-[[(2S)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]benzamide |
| SMILES | N#CCS(=O)(=O)NC(=O)c1ccc(-c2ccc(CCNC[C@@H](O)c3cccnc3)cc2)cc1OC1CCCCC1 |
| InChI | InChI=1S/C30H34N4O5S/c31-15-18-40(37,38)34-30(36)27-13-12-24(19-29(27)39-26-6-2-1-3-7-26)23-10-8-22(9-11-23)14-17-33-21-28(35)25-5-4-16-32-20-25/h4-5,8-13,16,19-20,26,28,33,35H,1-3,6-7,14,17-18,21H2,(H,34,36)/t28-/m1/s1 |
| InChIKey | MWDSYUIQEFAXMD-MUUNZHRXSA-N |
| XLogP | 3.91 |
| TPSA | 141.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.69 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|