C31H37N3O7S — CID 11699932
3-[[2-cyclohexyloxy-4-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]benzoyl]sulfamoyl]propanoic acid (PubChem CID 11699932) has the molecular formula C31H37N3O7S and a molecular weight of 595.72 g/mol. Its IUPAC name is 3-[[2-cyclohexyloxy-4-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]benzoyl]sulfamoyl]propanoic acid.
| Compound Name | 3-[[2-cyclohexyloxy-4-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]benzoyl]sulfamoyl]propanoic acid |
|---|---|
| PubChem CID | 11699932 |
| Molecular Formula | C31H37N3O7S |
| Molecular Weight | 595.72 g/mol |
| Exact Mass | 595.24 |
| IUPAC Name | 3-[[2-cyclohexyloxy-4-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]benzoyl]sulfamoyl]propanoic acid |
| SMILES | O=C(O)CCS(=O)(=O)NC(=O)c1ccc(-c2ccc(CCNC[C@H](O)c3cccnc3)cc2)cc1OC1CCCCC1 |
| InChI | InChI=1S/C31H37N3O7S/c35-28(25-5-4-16-32-20-25)21-33-17-14-22-8-10-23(11-9-22)24-12-13-27(29(19-24)41-26-6-2-1-3-7-26)31(38)34-42(39,40)18-15-30(36)37/h4-5,8-13,16,19-20,26,28,33,35H,1-3,6-7,14-15,17-18,21H2,(H,34,38)(H,36,37)/t28-/m0/s1 |
| InChIKey | WHWNBPTXOVHBBD-NDEPHWFRSA-N |
| XLogP | 3.86 |
| TPSA | 154.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.72 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|