C34H42N2O8S — CID 91124193
3-[4-[3-cyclohexyloxy-4-(3-hydroxypropylsulfonylcarbamoyl)phenyl]phenyl]propyl N-[(2R)-2-hydroxy-2-phenylethyl]carbamate (PubChem CID 91124193) has the molecular formula C34H42N2O8S and a molecular weight of 638.78 g/mol. Its IUPAC name is 3-[4-[3-cyclohexyloxy-4-(3-hydroxypropylsulfonylcarbamoyl)phenyl]phenyl]propyl N-[(2R)-2-hydroxy-2-phenylethyl]carbamate.
| Compound Name | 3-[4-[3-cyclohexyloxy-4-(3-hydroxypropylsulfonylcarbamoyl)phenyl]phenyl]propyl N-[(2R)-2-hydroxy-2-phenylethyl]carbamate |
|---|---|
| PubChem CID | 91124193 |
| Molecular Formula | C34H42N2O8S |
| Molecular Weight | 638.78 g/mol |
| Exact Mass | 638.27 |
| IUPAC Name | 3-[4-[3-cyclohexyloxy-4-(3-hydroxypropylsulfonylcarbamoyl)phenyl]phenyl]propyl N-[(2R)-2-hydroxy-2-phenylethyl]carbamate |
| SMILES | O=C(NC[C@H](O)c1ccccc1)OCCCc1ccc(-c2ccc(C(=O)NS(=O)(=O)CCCO)c(OC3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C34H42N2O8S/c37-20-8-22-45(41,42)36-33(39)30-19-18-28(23-32(30)44-29-12-5-2-6-13-29)26-16-14-25(15-17-26)9-7-21-43-34(40)35-24-31(38)27-10-3-1-4-11-27/h1,3-4,10-11,14-19,23,29,31,37-38H,2,5-9,12-13,20-22,24H2,(H,35,40)(H,36,39)/t31-/m0/s1 |
| InChIKey | UJZSYWSZCAVWKD-HKBQPEDESA-N |
| XLogP | 4.90 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.78 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|