C39H55N3O8SSi — CID 67098204
[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-pyridin-3-ylethyl]-[2-[4-[3-cyclohexyloxy-4-(4-hydroxybutylsulfonylcarbamoyl)phenyl]phenyl]ethyl]carbamic acid (PubChem CID 67098204) has the molecular formula C39H55N3O8SSi and a molecular weight of 754.04 g/mol. Its IUPAC name is [(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-pyridin-3-ylethyl]-[2-[4-[3-cyclohexyloxy-4-(4-hydroxybutylsulfonylcarbamoyl)phenyl]phenyl]ethyl]carbamic acid.
| Compound Name | [(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-pyridin-3-ylethyl]-[2-[4-[3-cyclohexyloxy-4-(4-hydroxybutylsulfonylcarbamoyl)phenyl]phenyl]ethyl]carbamic acid |
|---|---|
| PubChem CID | 67098204 |
| Molecular Formula | C39H55N3O8SSi |
| Molecular Weight | 754.04 g/mol |
| Exact Mass | 753.35 |
| IUPAC Name | [(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-pyridin-3-ylethyl]-[2-[4-[3-cyclohexyloxy-4-(4-hydroxybutylsulfonylcarbamoyl)phenyl]phenyl]ethyl]carbamic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](CN(CCc1ccc(-c2ccc(C(=O)NS(=O)(=O)CCCCO)c(OC3CCCCC3)c2)cc1)C(=O)O)c1cccnc1 |
| InChI | InChI=1S/C39H55N3O8SSi/c1-39(2,3)52(4,5)50-36(32-12-11-22-40-27-32)28-42(38(45)46)23-21-29-15-17-30(18-16-29)31-19-20-34(35(26-31)49-33-13-7-6-8-14-33)37(44)41-51(47,48)25-10-9-24-43/h11-12,15-20,22,26-27,33,36,43H,6-10,13-14,21,23-25,28H2,1-5H3,(H,41,44)(H,45,46)/t36-/m0/s1 |
| InChIKey | ROHLLISFRMNSEP-BHVANESWSA-N |
| XLogP | 7.58 |
| TPSA | 155.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.04 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|