C16H24BNO7S — CID 67098391
[3-cyclohexyloxy-4-(3-hydroxypropylsulfonylcarbamoyl)phenyl]boronic acid (PubChem CID 67098391) has the molecular formula C16H24BNO7S and a molecular weight of 385.25 g/mol. Its IUPAC name is [3-cyclohexyloxy-4-(3-hydroxypropylsulfonylcarbamoyl)phenyl]boronic acid.
| Compound Name | [3-cyclohexyloxy-4-(3-hydroxypropylsulfonylcarbamoyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 67098391 |
| Molecular Formula | C16H24BNO7S |
| Molecular Weight | 385.25 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | [3-cyclohexyloxy-4-(3-hydroxypropylsulfonylcarbamoyl)phenyl]boronic acid |
| SMILES | O=C(NS(=O)(=O)CCCO)c1ccc(B(O)O)cc1OC1CCCCC1 |
| InChI | InChI=1S/C16H24BNO7S/c19-9-4-10-26(23,24)18-16(20)14-8-7-12(17(21)22)11-15(14)25-13-5-2-1-3-6-13/h7-8,11,13,19,21-22H,1-6,9-10H2,(H,18,20) |
| InChIKey | JNAIILQHBCEWDC-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.25 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|