C12H18BNO5S — CID 67097987
(3-cyclohexyloxy-4-sulfamoylphenyl)boronic acid (PubChem CID 67097987) has the molecular formula C12H18BNO5S and a molecular weight of 299.16 g/mol. Its IUPAC name is (3-cyclohexyloxy-4-sulfamoylphenyl)boronic acid.
| Compound Name | (3-cyclohexyloxy-4-sulfamoylphenyl)boronic acid |
|---|---|
| PubChem CID | 67097987 |
| Molecular Formula | C12H18BNO5S |
| Molecular Weight | 299.16 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | (3-cyclohexyloxy-4-sulfamoylphenyl)boronic acid |
| SMILES | NS(=O)(=O)c1ccc(B(O)O)cc1OC1CCCCC1 |
| InChI | InChI=1S/C12H18BNO5S/c14-20(17,18)12-7-6-9(13(15)16)8-11(12)19-10-4-2-1-3-5-10/h6-8,10,15-16H,1-5H2,(H2,14,17,18) |
| InChIKey | KAECFWLUVLIQLM-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.16 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|