C24H24O5S2 — CID 54191170
2,4-bis(benzenesulfonyl)-1-cyclohexyloxybenzene (PubChem CID 54191170) has the molecular formula C24H24O5S2 and a molecular weight of 456.59 g/mol. Its IUPAC name is 2,4-bis(benzenesulfonyl)-1-cyclohexyloxybenzene.
| Compound Name | 2,4-bis(benzenesulfonyl)-1-cyclohexyloxybenzene |
|---|---|
| PubChem CID | 54191170 |
| Molecular Formula | C24H24O5S2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 2,4-bis(benzenesulfonyl)-1-cyclohexyloxybenzene |
| SMILES | O=S(=O)(c1ccccc1)c1ccc(OC2CCCCC2)c(S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C24H24O5S2/c25-30(26,20-12-6-2-7-13-20)22-16-17-23(29-19-10-4-1-5-11-19)24(18-22)31(27,28)21-14-8-3-9-15-21/h2-3,6-9,12-19H,1,4-5,10-11H2 |
| InChIKey | GAXAQJFPIGUZIS-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |