C22H28BNO8S — CID 142758368
[3-cyclohexyloxy-4-(2-phenylmethoxyethylsulfonylcarbamoyl)phenoxy]boronic acid (PubChem CID 142758368) has the molecular formula C22H28BNO8S and a molecular weight of 477.34 g/mol. Its IUPAC name is [3-cyclohexyloxy-4-(2-phenylmethoxyethylsulfonylcarbamoyl)phenoxy]boronic acid.
| Compound Name | [3-cyclohexyloxy-4-(2-phenylmethoxyethylsulfonylcarbamoyl)phenoxy]boronic acid |
|---|---|
| PubChem CID | 142758368 |
| Molecular Formula | C22H28BNO8S |
| Molecular Weight | 477.34 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | [3-cyclohexyloxy-4-(2-phenylmethoxyethylsulfonylcarbamoyl)phenoxy]boronic acid |
| SMILES | O=C(NS(=O)(=O)CCOCc1ccccc1)c1ccc(OB(O)O)cc1OC1CCCCC1 |
| InChI | InChI=1S/C22H28BNO8S/c25-22(24-33(28,29)14-13-30-16-17-7-3-1-4-8-17)20-12-11-19(32-23(26)27)15-21(20)31-18-9-5-2-6-10-18/h1,3-4,7-8,11-12,15,18,26-27H,2,5-6,9-10,13-14,16H2,(H,24,25) |
| InChIKey | JXMUVQOEMRCPHG-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|