C28H37Cl2N3O5S — CID 69102972
2-(2-ethoxyethylamino)-4-[4-[2-[[(2S)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-N-methylsulfonylbenzamide;dihydrochloride (PubChem CID 69102972) has the molecular formula C28H37Cl2N3O5S and a molecular weight of 598.59 g/mol. Its IUPAC name is 2-(2-ethoxyethylamino)-4-[4-[2-[[(2S)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-N-methylsulfonylbenzamide;dihydrochloride.
| Compound Name | 2-(2-ethoxyethylamino)-4-[4-[2-[[(2S)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-N-methylsulfonylbenzamide;dihydrochloride |
|---|---|
| PubChem CID | 69102972 |
| Molecular Formula | C28H37Cl2N3O5S |
| Molecular Weight | 598.59 g/mol |
| Exact Mass | 597.18 |
| IUPAC Name | 2-(2-ethoxyethylamino)-4-[4-[2-[[(2S)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-N-methylsulfonylbenzamide;dihydrochloride |
| SMILES | CCOCCNc1cc(-c2ccc(CCNC[C@@H](O)c3ccccc3)cc2)ccc1C(=O)NS(C)(=O)=O.Cl.Cl |
| InChI | InChI=1S/C28H35N3O5S.2ClH/c1-3-36-18-17-30-26-19-24(13-14-25(26)28(33)31-37(2,34)35)22-11-9-21(10-12-22)15-16-29-20-27(32)23-7-5-4-6-8-23;;/h4-14,19,27,29-30,32H,3,15-18,20H2,1-2H3,(H,31,33);2*1H/t27-;;/m1../s1 |
| InChIKey | KFDRKURJOYACAD-KFSCGDPASA-N |
| XLogP | 4.20 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.59 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|