C25H27ClN2O4 — CID 69103241
2-acetamido-4-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]benzoic acid;hydrochloride (PubChem CID 69103241) has the molecular formula C25H27ClN2O4 and a molecular weight of 454.95 g/mol. Its IUPAC name is 2-acetamido-4-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]benzoic acid;hydrochloride.
| Compound Name | 2-acetamido-4-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 69103241 |
| Molecular Formula | C25H27ClN2O4 |
| Molecular Weight | 454.95 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 2-acetamido-4-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]benzoic acid;hydrochloride |
| SMILES | CC(=O)Nc1cc(-c2ccc(CCNC[C@H](O)c3ccccc3)cc2)ccc1C(=O)O.Cl |
| InChI | InChI=1S/C25H26N2O4.ClH/c1-17(28)27-23-15-21(11-12-22(23)25(30)31)19-9-7-18(8-10-19)13-14-26-16-24(29)20-5-3-2-4-6-20;/h2-12,15,24,26,29H,13-14,16H2,1H3,(H,27,28)(H,30,31);1H/t24-;/m0./s1 |
| InChIKey | XNAICPPEQJSIGH-JIDHJSLPSA-N |
| XLogP | 4.30 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.95 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|