C24H22Cl2F3NO3 — CID 69102599
4-[4-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]-2-(trifluoromethyl)benzoic acid;hydrochloride (PubChem CID 69102599) has the molecular formula C24H22Cl2F3NO3 and a molecular weight of 500.34 g/mol. Its IUPAC name is 4-[4-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]-2-(trifluoromethyl)benzoic acid;hydrochloride.
| Compound Name | 4-[4-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]-2-(trifluoromethyl)benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 69102599 |
| Molecular Formula | C24H22Cl2F3NO3 |
| Molecular Weight | 500.34 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | 4-[4-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]-2-(trifluoromethyl)benzoic acid;hydrochloride |
| SMILES | Cl.O=C(O)c1ccc(-c2ccc(CCNC[C@H](O)c3cccc(Cl)c3)cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C24H21ClF3NO3.ClH/c25-19-3-1-2-18(12-19)22(30)14-29-11-10-15-4-6-16(7-5-15)17-8-9-20(23(31)32)21(13-17)24(26,27)28;/h1-9,12-13,22,29-30H,10-11,14H2,(H,31,32);1H/t22-;/m0./s1 |
| InChIKey | BHNDOSRYGSBVKT-FTBISJDPSA-N |
| XLogP | 6.01 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.34 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|