C26H30ClNO4 — CID 69102561
2-ethoxy-4-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-3-methylbenzoic acid;hydrochloride (PubChem CID 69102561) has the molecular formula C26H30ClNO4 and a molecular weight of 455.98 g/mol. Its IUPAC name is 2-ethoxy-4-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-3-methylbenzoic acid;hydrochloride.
| Compound Name | 2-ethoxy-4-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-3-methylbenzoic acid;hydrochloride |
|---|---|
| PubChem CID | 69102561 |
| Molecular Formula | C26H30ClNO4 |
| Molecular Weight | 455.98 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 2-ethoxy-4-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-3-methylbenzoic acid;hydrochloride |
| SMILES | CCOc1c(C(=O)O)ccc(-c2ccc(CCNC[C@H](O)c3ccccc3)cc2)c1C.Cl |
| InChI | InChI=1S/C26H29NO4.ClH/c1-3-31-25-18(2)22(13-14-23(25)26(29)30)20-11-9-19(10-12-20)15-16-27-17-24(28)21-7-5-4-6-8-21;/h4-14,24,27-28H,3,15-17H2,1-2H3,(H,29,30);1H/t24-;/m0./s1 |
| InChIKey | JHOANROYSIHUBN-JIDHJSLPSA-N |
| XLogP | 5.05 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.98 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|