C26H29NO3 — CID 69058630
4-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-2-propylbenzoic acid (PubChem CID 69058630) has the molecular formula C26H29NO3 and a molecular weight of 403.52 g/mol. Its IUPAC name is 4-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-2-propylbenzoic acid.
| Compound Name | 4-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-2-propylbenzoic acid |
|---|---|
| PubChem CID | 69058630 |
| Molecular Formula | C26H29NO3 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | 4-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-2-propylbenzoic acid |
| SMILES | CCCc1cc(-c2ccc(CCNC[C@H](O)c3ccccc3)cc2)ccc1C(=O)O |
| InChI | InChI=1S/C26H29NO3/c1-2-6-23-17-22(13-14-24(23)26(29)30)20-11-9-19(10-12-20)15-16-27-18-25(28)21-7-4-3-5-8-21/h3-5,7-14,17,25,27-28H,2,6,15-16,18H2,1H3,(H,29,30)/t25-/m0/s1 |
| InChIKey | FVNNMZMUZWCFKE-VWLOTQADSA-N |
| XLogP | 4.87 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|