C26H30N2O4S2 — CID 69104339
2-ethylsulfanyl-4-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-N-methylsulfonylbenzamide (PubChem CID 69104339) has the molecular formula C26H30N2O4S2 and a molecular weight of 498.67 g/mol. Its IUPAC name is 2-ethylsulfanyl-4-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-N-methylsulfonylbenzamide.
| Compound Name | 2-ethylsulfanyl-4-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-N-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 69104339 |
| Molecular Formula | C26H30N2O4S2 |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | 2-ethylsulfanyl-4-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-N-methylsulfonylbenzamide |
| SMILES | CCSc1cc(-c2ccc(CCNC[C@H](O)c3ccccc3)cc2)ccc1C(=O)NS(C)(=O)=O |
| InChI | InChI=1S/C26H30N2O4S2/c1-3-33-25-17-22(13-14-23(25)26(30)28-34(2,31)32)20-11-9-19(10-12-20)15-16-27-18-24(29)21-7-5-4-6-8-21/h4-14,17,24,27,29H,3,15-16,18H2,1-2H3,(H,28,30)/t24-/m0/s1 |
| InChIKey | NYBFSWULONCUNG-DEOSSOPVSA-N |
| XLogP | 4.02 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|