C27H34Cl2N2O3 — CID 69103873
4-[4-[2-[[(2S)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-2-[methyl(propan-2-yl)amino]benzoic acid;dihydrochloride (PubChem CID 69103873) has the molecular formula C27H34Cl2N2O3 and a molecular weight of 505.49 g/mol. Its IUPAC name is 4-[4-[2-[[(2S)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-2-[methyl(propan-2-yl)amino]benzoic acid;dihydrochloride.
| Compound Name | 4-[4-[2-[[(2S)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-2-[methyl(propan-2-yl)amino]benzoic acid;dihydrochloride |
|---|---|
| PubChem CID | 69103873 |
| Molecular Formula | C27H34Cl2N2O3 |
| Molecular Weight | 505.49 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | 4-[4-[2-[[(2S)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-2-[methyl(propan-2-yl)amino]benzoic acid;dihydrochloride |
| SMILES | CC(C)N(C)c1cc(-c2ccc(CCNC[C@@H](O)c3ccccc3)cc2)ccc1C(=O)O.Cl.Cl |
| InChI | InChI=1S/C27H32N2O3.2ClH/c1-19(2)29(3)25-17-23(13-14-24(25)27(31)32)21-11-9-20(10-12-21)15-16-28-18-26(30)22-7-5-4-6-8-22;;/h4-14,17,19,26,28,30H,15-16,18H2,1-3H3,(H,31,32);2*1H/t26-;;/m1../s1 |
| InChIKey | RJKRADJUTGSTTN-FBHGDYMESA-N |
| XLogP | 5.61 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.49 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|