C27H32ClNO3 — CID 69102858
4-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-3-(2-methylpropyl)benzoic acid;hydrochloride (PubChem CID 69102858) has the molecular formula C27H32ClNO3 and a molecular weight of 454.01 g/mol. Its IUPAC name is 4-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-3-(2-methylpropyl)benzoic acid;hydrochloride.
| Compound Name | 4-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-3-(2-methylpropyl)benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 69102858 |
| Molecular Formula | C27H32ClNO3 |
| Molecular Weight | 454.01 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | 4-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-3-(2-methylpropyl)benzoic acid;hydrochloride |
| SMILES | CC(C)Cc1cc(C(=O)O)ccc1-c1ccc(CCNC[C@H](O)c2ccccc2)cc1.Cl |
| InChI | InChI=1S/C27H31NO3.ClH/c1-19(2)16-24-17-23(27(30)31)12-13-25(24)21-10-8-20(9-11-21)14-15-28-18-26(29)22-6-4-3-5-7-22;/h3-13,17,19,26,28-29H,14-16,18H2,1-2H3,(H,30,31);1H/t26-;/m0./s1 |
| InChIKey | DHRJVNQWJAOHBA-SNYZSRNZSA-N |
| XLogP | 5.54 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.01 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|