C31H39N3O6S — CID 91023982
N-[2-[[(2R)-2-(4-aminophenyl)-2-hydroxyethyl]amino]ethoxy]-2-cyclopentyl-N-(3-hydroxypropylsulfonyl)-4-phenylbenzamide (PubChem CID 91023982) has the molecular formula C31H39N3O6S and a molecular weight of 581.74 g/mol. Its IUPAC name is N-[2-[[(2R)-2-(4-aminophenyl)-2-hydroxyethyl]amino]ethoxy]-2-cyclopentyl-N-(3-hydroxypropylsulfonyl)-4-phenylbenzamide.
| Compound Name | N-[2-[[(2R)-2-(4-aminophenyl)-2-hydroxyethyl]amino]ethoxy]-2-cyclopentyl-N-(3-hydroxypropylsulfonyl)-4-phenylbenzamide |
|---|---|
| PubChem CID | 91023982 |
| Molecular Formula | C31H39N3O6S |
| Molecular Weight | 581.74 g/mol |
| Exact Mass | 581.26 |
| IUPAC Name | N-[2-[[(2R)-2-(4-aminophenyl)-2-hydroxyethyl]amino]ethoxy]-2-cyclopentyl-N-(3-hydroxypropylsulfonyl)-4-phenylbenzamide |
| SMILES | Nc1ccc([C@@H](O)CNCCON(C(=O)c2ccc(-c3ccccc3)cc2C2CCCC2)S(=O)(=O)CCCO)cc1 |
| InChI | InChI=1S/C31H39N3O6S/c32-27-14-11-25(12-15-27)30(36)22-33-17-19-40-34(41(38,39)20-6-18-35)31(37)28-16-13-26(23-7-2-1-3-8-23)21-29(28)24-9-4-5-10-24/h1-3,7-8,11-16,21,24,30,33,35-36H,4-6,9-10,17-20,22,32H2/t30-/m0/s1 |
| InChIKey | FAHXJPQZBAPCBC-PMERELPUSA-N |
| XLogP | 4.00 |
| TPSA | 142.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.74 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|