C27H32N2O6S — CID 69103271
4-[4-[2-[[(2S)-2-hydroxy-2-[3-(methanesulfonamido)phenyl]ethyl]amino]ethyl]phenyl]-2-propan-2-yloxybenzoic acid (PubChem CID 69103271) has the molecular formula C27H32N2O6S and a molecular weight of 512.63 g/mol. Its IUPAC name is 4-[4-[2-[[(2S)-2-hydroxy-2-[3-(methanesulfonamido)phenyl]ethyl]amino]ethyl]phenyl]-2-propan-2-yloxybenzoic acid.
| Compound Name | 4-[4-[2-[[(2S)-2-hydroxy-2-[3-(methanesulfonamido)phenyl]ethyl]amino]ethyl]phenyl]-2-propan-2-yloxybenzoic acid |
|---|---|
| PubChem CID | 69103271 |
| Molecular Formula | C27H32N2O6S |
| Molecular Weight | 512.63 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | 4-[4-[2-[[(2S)-2-hydroxy-2-[3-(methanesulfonamido)phenyl]ethyl]amino]ethyl]phenyl]-2-propan-2-yloxybenzoic acid |
| SMILES | CC(C)Oc1cc(-c2ccc(CCNC[C@@H](O)c3cccc(NS(C)(=O)=O)c3)cc2)ccc1C(=O)O |
| InChI | InChI=1S/C27H32N2O6S/c1-18(2)35-26-16-21(11-12-24(26)27(31)32)20-9-7-19(8-10-20)13-14-28-17-25(30)22-5-4-6-23(15-22)29-36(3,33)34/h4-12,15-16,18,25,28-30H,13-14,17H2,1-3H3,(H,31,32)/t25-/m1/s1 |
| InChIKey | XJQYLEOYVGHTNH-RUZDIDTESA-N |
| XLogP | 4.08 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.63 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|