C26H28ClNO5 — CID 69103207
4-[4-[2-[[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethoxy]phenyl]-2-propan-2-yloxybenzoic acid (PubChem CID 69103207) has the molecular formula C26H28ClNO5 and a molecular weight of 469.97 g/mol. Its IUPAC name is 4-[4-[2-[[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethoxy]phenyl]-2-propan-2-yloxybenzoic acid.
| Compound Name | 4-[4-[2-[[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethoxy]phenyl]-2-propan-2-yloxybenzoic acid |
|---|---|
| PubChem CID | 69103207 |
| Molecular Formula | C26H28ClNO5 |
| Molecular Weight | 469.97 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | 4-[4-[2-[[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethoxy]phenyl]-2-propan-2-yloxybenzoic acid |
| SMILES | CC(C)Oc1cc(-c2ccc(OCCNC[C@@H](O)c3cccc(Cl)c3)cc2)ccc1C(=O)O |
| InChI | InChI=1S/C26H28ClNO5/c1-17(2)33-25-15-19(8-11-23(25)26(30)31)18-6-9-22(10-7-18)32-13-12-28-16-24(29)20-4-3-5-21(27)14-20/h3-11,14-15,17,24,28-29H,12-13,16H2,1-2H3,(H,30,31)/t24-/m1/s1 |
| InChIKey | DNHKRHGHMJZIBE-XMMPIXPASA-N |
| XLogP | 5.19 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.97 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|