C33H36N2O8S — CID 69202846
2-ethoxy-4-[4-[2-[[(2R)-2-hydroxy-2-[3-(methanesulfonamido)-4-phenylmethoxyphenyl]ethyl]amino]ethoxy]phenyl]benzoic acid (PubChem CID 69202846) has the molecular formula C33H36N2O8S and a molecular weight of 620.72 g/mol. Its IUPAC name is 2-ethoxy-4-[4-[2-[[(2R)-2-hydroxy-2-[3-(methanesulfonamido)-4-phenylmethoxyphenyl]ethyl]amino]ethoxy]phenyl]benzoic acid.
| Compound Name | 2-ethoxy-4-[4-[2-[[(2R)-2-hydroxy-2-[3-(methanesulfonamido)-4-phenylmethoxyphenyl]ethyl]amino]ethoxy]phenyl]benzoic acid |
|---|---|
| PubChem CID | 69202846 |
| Molecular Formula | C33H36N2O8S |
| Molecular Weight | 620.72 g/mol |
| Exact Mass | 620.22 |
| IUPAC Name | 2-ethoxy-4-[4-[2-[[(2R)-2-hydroxy-2-[3-(methanesulfonamido)-4-phenylmethoxyphenyl]ethyl]amino]ethoxy]phenyl]benzoic acid |
| SMILES | CCOc1cc(-c2ccc(OCCNC[C@H](O)c3ccc(OCc4ccccc4)c(NS(C)(=O)=O)c3)cc2)ccc1C(=O)O |
| InChI | InChI=1S/C33H36N2O8S/c1-3-41-32-20-25(11-15-28(32)33(37)38)24-9-13-27(14-10-24)42-18-17-34-21-30(36)26-12-16-31(29(19-26)35-44(2,39)40)43-22-23-7-5-4-6-8-23/h4-16,19-20,30,34-36H,3,17-18,21-22H2,1-2H3,(H,37,38)/t30-/m0/s1 |
| InChIKey | JMCJWTLNMMTXKE-PMERELPUSA-N |
| XLogP | 5.10 |
| TPSA | 143.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.72 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|