C32H34N2O7S — CID 91102840
2-[[(2R)-2-hydroxy-2-[3-(methanesulfonamido)-4-phenylmethoxyphenyl]ethyl]amino]ethyl 3-methyl-4-phenylbenzenecarboperoxoate (PubChem CID 91102840) has the molecular formula C32H34N2O7S and a molecular weight of 590.70 g/mol. Its IUPAC name is 2-[[(2R)-2-hydroxy-2-[3-(methanesulfonamido)-4-phenylmethoxyphenyl]ethyl]amino]ethyl 3-methyl-4-phenylbenzenecarboperoxoate.
| Compound Name | 2-[[(2R)-2-hydroxy-2-[3-(methanesulfonamido)-4-phenylmethoxyphenyl]ethyl]amino]ethyl 3-methyl-4-phenylbenzenecarboperoxoate |
|---|---|
| PubChem CID | 91102840 |
| Molecular Formula | C32H34N2O7S |
| Molecular Weight | 590.70 g/mol |
| Exact Mass | 590.21 |
| IUPAC Name | 2-[[(2R)-2-hydroxy-2-[3-(methanesulfonamido)-4-phenylmethoxyphenyl]ethyl]amino]ethyl 3-methyl-4-phenylbenzenecarboperoxoate |
| SMILES | Cc1cc(C(=O)OOCCNC[C@H](O)c2ccc(OCc3ccccc3)c(NS(C)(=O)=O)c2)ccc1-c1ccccc1 |
| InChI | InChI=1S/C32H34N2O7S/c1-23-19-27(13-15-28(23)25-11-7-4-8-12-25)32(36)41-40-18-17-33-21-30(35)26-14-16-31(29(20-26)34-42(2,37)38)39-22-24-9-5-3-6-10-24/h3-16,19-20,30,33-35H,17-18,21-22H2,1-2H3/t30-/m0/s1 |
| InChIKey | LJWHEWTYODIDQN-PMERELPUSA-N |
| XLogP | 5.02 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.70 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|