C40H42N2O7S — CID 69202804
benzyl 4-[4-[2-[[(2R)-2-hydroxy-2-[3-(methanesulfonamido)-4-phenylmethoxyphenyl]ethyl]amino]ethoxy]-2,3-dimethylphenyl]benzoate (PubChem CID 69202804) has the molecular formula C40H42N2O7S and a molecular weight of 694.85 g/mol. Its IUPAC name is benzyl 4-[4-[2-[[(2R)-2-hydroxy-2-[3-(methanesulfonamido)-4-phenylmethoxyphenyl]ethyl]amino]ethoxy]-2,3-dimethylphenyl]benzoate.
| Compound Name | benzyl 4-[4-[2-[[(2R)-2-hydroxy-2-[3-(methanesulfonamido)-4-phenylmethoxyphenyl]ethyl]amino]ethoxy]-2,3-dimethylphenyl]benzoate |
|---|---|
| PubChem CID | 69202804 |
| Molecular Formula | C40H42N2O7S |
| Molecular Weight | 694.85 g/mol |
| Exact Mass | 694.27 |
| IUPAC Name | benzyl 4-[4-[2-[[(2R)-2-hydroxy-2-[3-(methanesulfonamido)-4-phenylmethoxyphenyl]ethyl]amino]ethoxy]-2,3-dimethylphenyl]benzoate |
| SMILES | Cc1c(OCCNC[C@H](O)c2ccc(OCc3ccccc3)c(NS(C)(=O)=O)c2)ccc(-c2ccc(C(=O)OCc3ccccc3)cc2)c1C |
| InChI | InChI=1S/C40H42N2O7S/c1-28-29(2)38(21-19-35(28)32-14-16-33(17-15-32)40(44)49-27-31-12-8-5-9-13-31)47-23-22-41-25-37(43)34-18-20-39(36(24-34)42-50(3,45)46)48-26-30-10-6-4-7-11-30/h4-21,24,37,41-43H,22-23,25-27H2,1-3H3/t37-/m0/s1 |
| InChIKey | PLXXSPKMMYCLFR-QNGWXLTQSA-N |
| XLogP | 6.98 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.85 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|