C31H33N3O5S2 — CID 18615081
3-[2-[[2-[3-(dimethylsulfamoylamino)-4-phenylmethoxyphenyl]-2-hydroxyethyl]amino]ethoxy]dibenzothiophene (PubChem CID 18615081) has the molecular formula C31H33N3O5S2 and a molecular weight of 591.76 g/mol. Its IUPAC name is 3-[2-[[2-[3-(dimethylsulfamoylamino)-4-phenylmethoxyphenyl]-2-hydroxyethyl]amino]ethoxy]dibenzothiophene.
| Compound Name | 3-[2-[[2-[3-(dimethylsulfamoylamino)-4-phenylmethoxyphenyl]-2-hydroxyethyl]amino]ethoxy]dibenzothiophene |
|---|---|
| PubChem CID | 18615081 |
| Molecular Formula | C31H33N3O5S2 |
| Molecular Weight | 591.76 g/mol |
| Exact Mass | 591.19 |
| IUPAC Name | 3-[2-[[2-[3-(dimethylsulfamoylamino)-4-phenylmethoxyphenyl]-2-hydroxyethyl]amino]ethoxy]dibenzothiophene |
| SMILES | CN(C)S(=O)(=O)Nc1cc(C(O)CNCCOc2ccc3c(c2)sc2ccccc23)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C31H33N3O5S2/c1-34(2)41(36,37)33-27-18-23(12-15-29(27)39-21-22-8-4-3-5-9-22)28(35)20-32-16-17-38-24-13-14-26-25-10-6-7-11-30(25)40-31(26)19-24/h3-15,18-19,28,32-33,35H,16-17,20-21H2,1-2H3 |
| InChIKey | RSBCVWOAOBPJFJ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.76 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|