C37H37N3O5S — CID 11734879
N-[5-[2-[2-(9H-carbazol-2-yloxy)ethylamino]-1-phenylmethoxyethyl]-2-phenylmethoxyphenyl]methanesulfonamide (PubChem CID 11734879) has the molecular formula C37H37N3O5S and a molecular weight of 635.79 g/mol. Its IUPAC name is N-[5-[2-[2-(9H-carbazol-2-yloxy)ethylamino]-1-phenylmethoxyethyl]-2-phenylmethoxyphenyl]methanesulfonamide.
| Compound Name | N-[5-[2-[2-(9H-carbazol-2-yloxy)ethylamino]-1-phenylmethoxyethyl]-2-phenylmethoxyphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 11734879 |
| Molecular Formula | C37H37N3O5S |
| Molecular Weight | 635.79 g/mol |
| Exact Mass | 635.25 |
| IUPAC Name | N-[5-[2-[2-(9H-carbazol-2-yloxy)ethylamino]-1-phenylmethoxyethyl]-2-phenylmethoxyphenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cc(C(CNCCOc2ccc3c(c2)[nH]c2ccccc23)OCc2ccccc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C37H37N3O5S/c1-46(41,42)40-35-22-29(16-19-36(35)44-25-27-10-4-2-5-11-27)37(45-26-28-12-6-3-7-13-28)24-38-20-21-43-30-17-18-32-31-14-8-9-15-33(31)39-34(32)23-30/h2-19,22-23,37-40H,20-21,24-26H2,1H3 |
| InChIKey | BEYBLJIHHDYWIR-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 101.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.79 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|