C30H31N3O3 — CID 70187925
2-[2-(9H-carbazol-2-yloxy)ethylamino]-2-[3-(methylamino)-4-phenylmethoxyphenyl]ethanol (PubChem CID 70187925) has the molecular formula C30H31N3O3 and a molecular weight of 481.60 g/mol. Its IUPAC name is 2-[2-(9H-carbazol-2-yloxy)ethylamino]-2-[3-(methylamino)-4-phenylmethoxyphenyl]ethanol.
| Compound Name | 2-[2-(9H-carbazol-2-yloxy)ethylamino]-2-[3-(methylamino)-4-phenylmethoxyphenyl]ethanol |
|---|---|
| PubChem CID | 70187925 |
| Molecular Formula | C30H31N3O3 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | 2-[2-(9H-carbazol-2-yloxy)ethylamino]-2-[3-(methylamino)-4-phenylmethoxyphenyl]ethanol |
| SMILES | CNc1cc(C(CO)NCCOc2ccc3c(c2)[nH]c2ccccc23)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C30H31N3O3/c1-31-28-17-22(11-14-30(28)36-20-21-7-3-2-4-8-21)29(19-34)32-15-16-35-23-12-13-25-24-9-5-6-10-26(24)33-27(25)18-23/h2-14,17-18,29,31-34H,15-16,19-20H2,1H3 |
| InChIKey | LROKEEBMYVWKQU-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 78.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|