C14H20N2O2 — CID 160532929
1-[2-[(2,3-dimethyl-1H-indol-6-yl)oxy]ethylamino]ethanol (PubChem CID 160532929) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 1-[2-[(2,3-dimethyl-1H-indol-6-yl)oxy]ethylamino]ethanol.
| Compound Name | 1-[2-[(2,3-dimethyl-1H-indol-6-yl)oxy]ethylamino]ethanol |
|---|---|
| PubChem CID | 160532929 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 1-[2-[(2,3-dimethyl-1H-indol-6-yl)oxy]ethylamino]ethanol |
| SMILES | Cc1[nH]c2cc(OCCNC(C)O)ccc2c1C |
| InChI | InChI=1S/C14H20N2O2/c1-9-10(2)16-14-8-12(4-5-13(9)14)18-7-6-15-11(3)17/h4-5,8,11,15-17H,6-7H2,1-3H3 |
| InChIKey | QVUBEYPODSGFKT-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 57.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|