C27H40ClN3O4SSi — CID 69348614
N-[2-chloro-5-[(1R)-2-[2-[(2,3-dimethyl-1H-indol-6-yl)oxy]ethylamino]-1-triethylsilyloxyethyl]phenyl]methanesulfonamide (PubChem CID 69348614) has the molecular formula C27H40ClN3O4SSi and a molecular weight of 566.24 g/mol. Its IUPAC name is N-[2-chloro-5-[(1R)-2-[2-[(2,3-dimethyl-1H-indol-6-yl)oxy]ethylamino]-1-triethylsilyloxyethyl]phenyl]methanesulfonamide.
| Compound Name | N-[2-chloro-5-[(1R)-2-[2-[(2,3-dimethyl-1H-indol-6-yl)oxy]ethylamino]-1-triethylsilyloxyethyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 69348614 |
| Molecular Formula | C27H40ClN3O4SSi |
| Molecular Weight | 566.24 g/mol |
| Exact Mass | 565.22 |
| IUPAC Name | N-[2-chloro-5-[(1R)-2-[2-[(2,3-dimethyl-1H-indol-6-yl)oxy]ethylamino]-1-triethylsilyloxyethyl]phenyl]methanesulfonamide |
| SMILES | CC[Si](CC)(CC)O[C@@H](CNCCOc1ccc2c(C)c(C)[nH]c2c1)c1ccc(Cl)c(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C27H40ClN3O4SSi/c1-7-37(8-2,9-3)35-27(21-10-13-24(28)26(16-21)31-36(6,32)33)18-29-14-15-34-22-11-12-23-19(4)20(5)30-25(23)17-22/h10-13,16-17,27,29-31H,7-9,14-15,18H2,1-6H3/t27-/m0/s1 |
| InChIKey | VAJAFWDNEVKHTH-MHZLTWQESA-N |
| XLogP | 6.54 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.24 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|