C23H23BrClN3O4S — CID 70034972
N-[2-bromo-5-[(1R)-2-[2-[(7-chloro-9H-carbazol-2-yl)oxy]ethylamino]-1-hydroxyethyl]phenyl]methanesulfonamide (PubChem CID 70034972) has the molecular formula C23H23BrClN3O4S and a molecular weight of 552.88 g/mol. Its IUPAC name is N-[2-bromo-5-[(1R)-2-[2-[(7-chloro-9H-carbazol-2-yl)oxy]ethylamino]-1-hydroxyethyl]phenyl]methanesulfonamide.
| Compound Name | N-[2-bromo-5-[(1R)-2-[2-[(7-chloro-9H-carbazol-2-yl)oxy]ethylamino]-1-hydroxyethyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 70034972 |
| Molecular Formula | C23H23BrClN3O4S |
| Molecular Weight | 552.88 g/mol |
| Exact Mass | 551.03 |
| IUPAC Name | N-[2-bromo-5-[(1R)-2-[2-[(7-chloro-9H-carbazol-2-yl)oxy]ethylamino]-1-hydroxyethyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cc([C@@H](O)CNCCOc2ccc3c(c2)[nH]c2cc(Cl)ccc23)ccc1Br |
| InChI | InChI=1S/C23H23BrClN3O4S/c1-33(30,31)28-22-10-14(2-7-19(22)24)23(29)13-26-8-9-32-16-4-6-18-17-5-3-15(25)11-20(17)27-21(18)12-16/h2-7,10-12,23,26-29H,8-9,13H2,1H3/t23-/m0/s1 |
| InChIKey | HKLIIMOZZZMXGM-QHCPKHFHSA-N |
| XLogP | 4.81 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.88 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|