C23H29ClFN3O4S — CID 22111254
N-[2-fluoro-5-[1-hydroxy-2-[2-(6,7,8,9-tetrahydro-5H-carbazol-2-yloxy)ethylamino]ethyl]phenyl]methanesulfonamide;hydrochloride (PubChem CID 22111254) has the molecular formula C23H29ClFN3O4S and a molecular weight of 498.02 g/mol. Its IUPAC name is N-[2-fluoro-5-[1-hydroxy-2-[2-(6,7,8,9-tetrahydro-5H-carbazol-2-yloxy)ethylamino]ethyl]phenyl]methanesulfonamide;hydrochloride.
| Compound Name | N-[2-fluoro-5-[1-hydroxy-2-[2-(6,7,8,9-tetrahydro-5H-carbazol-2-yloxy)ethylamino]ethyl]phenyl]methanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 22111254 |
| Molecular Formula | C23H29ClFN3O4S |
| Molecular Weight | 498.02 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | N-[2-fluoro-5-[1-hydroxy-2-[2-(6,7,8,9-tetrahydro-5H-carbazol-2-yloxy)ethylamino]ethyl]phenyl]methanesulfonamide;hydrochloride |
| SMILES | CS(=O)(=O)Nc1cc(C(O)CNCCOc2ccc3c4c([nH]c3c2)CCCC4)ccc1F.Cl |
| InChI | InChI=1S/C23H28FN3O4S.ClH/c1-32(29,30)27-22-12-15(6-9-19(22)24)23(28)14-25-10-11-31-16-7-8-18-17-4-2-3-5-20(17)26-21(18)13-16;/h6-9,12-13,23,25-28H,2-5,10-11,14H2,1H3;1H |
| InChIKey | KKCIUBIAHACYNU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.02 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|